C19H25NO2S2 — CID 53096178
1-(2,5-dimethylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane (PubChem CID 53096178) has the molecular formula C19H25NO2S2 and a molecular weight of 363.55 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane |
|---|---|
| PubChem CID | 53096178 |
| Molecular Formula | C19H25NO2S2 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCCCC2c2ccc(C)s2)c1 |
| InChI | InChI=1S/C19H25NO2S2/c1-14-8-9-15(2)19(13-14)24(21,22)20-12-6-4-5-7-17(20)18-11-10-16(3)23-18/h8-11,13,17H,4-7,12H2,1-3H3 |
| InChIKey | AKJDOPUCJUOWKN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |