C21H29NO2S2 — CID 93076646
(2S)-1-(4-tert-butylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane (PubChem CID 93076646) has the molecular formula C21H29NO2S2 and a molecular weight of 391.60 g/mol. Its IUPAC name is (2S)-1-(4-tert-butylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane.
| Compound Name | (2S)-1-(4-tert-butylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane |
|---|---|
| PubChem CID | 93076646 |
| Molecular Formula | C21H29NO2S2 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (2S)-1-(4-tert-butylphenyl)sulfonyl-2-(5-methylthiophen-2-yl)azepane |
| SMILES | Cc1ccc([C@@H]2CCCCCN2S(=O)(=O)c2ccc(C(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C21H29NO2S2/c1-16-9-14-20(25-16)19-8-6-5-7-15-22(19)26(23,24)18-12-10-17(11-13-18)21(2,3)4/h9-14,19H,5-8,15H2,1-4H3/t19-/m0/s1 |
| InChIKey | GJCLEWFPLQVGQJ-IBGZPJMESA-N |
| XLogP | 5.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |