C19H20N2O3S2 — CID 51249614
2-[1-(2-methoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole (PubChem CID 51249614) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(2-methoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 51249614 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole |
| SMILES | COc1ccccc1S(=O)(=O)N1CCCCC1c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-24-16-10-3-5-12-18(16)26(22,23)21-13-7-6-9-15(21)19-20-14-8-2-4-11-17(14)25-19/h2-5,8,10-12,15H,6-7,9,13H2,1H3 |
| InChIKey | XVAYBVWJHSCTQX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |