C20H22N2O4S2 — CID 55435590
2-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole (PubChem CID 55435590) has the molecular formula C20H22N2O4S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 2-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 55435590 |
| Molecular Formula | C20H22N2O4S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 2-[1-(2,5-dimethoxyphenyl)sulfonylpiperidin-2-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCCCC2c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C20H22N2O4S2/c1-25-14-10-11-17(26-2)19(13-14)28(23,24)22-12-6-5-8-16(22)20-21-15-7-3-4-9-18(15)27-20/h3-4,7,9-11,13,16H,5-6,8,12H2,1-2H3 |
| InChIKey | MSTGGGOBBNZPSO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |