C17H20N2O4S — CID 30747502
4-[(2S)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-2-yl]pyridine (PubChem CID 30747502) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-[(2S)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-2-yl]pyridine.
| Compound Name | 4-[(2S)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 30747502 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 4-[(2S)-1-(2,5-dimethoxyphenyl)sulfonylpyrrolidin-2-yl]pyridine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCC[C@H]2c2ccncc2)c1 |
| InChI | InChI=1S/C17H20N2O4S/c1-22-14-5-6-16(23-2)17(12-14)24(20,21)19-11-3-4-15(19)13-7-9-18-10-8-13/h5-10,12,15H,3-4,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | VMXSPBXMFUBHHH-HNNXBMFYSA-N |
| XLogP | 2.62 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |