C17H24N2O5S — CID 46956605
1-[(4aR,7aR)-1-(2,5-dimethoxyphenyl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]ethanone (PubChem CID 46956605) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 1-[(4aR,7aR)-1-(2,5-dimethoxyphenyl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]ethanone.
| Compound Name | 1-[(4aR,7aR)-1-(2,5-dimethoxyphenyl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 46956605 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[(4aR,7aR)-1-(2,5-dimethoxyphenyl)sulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]ethanone |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCC[C@@H]3CN(C(C)=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C17H24N2O5S/c1-12(20)18-10-13-5-4-8-19(15(13)11-18)25(21,22)17-9-14(23-2)6-7-16(17)24-3/h6-7,9,13,15H,4-5,8,10-11H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | XJUVPMHRUASBSL-HIFRSBDPSA-N |
| XLogP | 1.34 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |