C16H23NO5S — CID 51984083
(4aS,8aR)-4-(2,5-dimethoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 51984083) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is (4aS,8aR)-4-(2,5-dimethoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aS,8aR)-4-(2,5-dimethoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 51984083 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (4aS,8aR)-4-(2,5-dimethoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCO[C@@H]3CCCC[C@@H]32)c1 |
| InChI | InChI=1S/C16H23NO5S/c1-20-12-7-8-15(21-2)16(11-12)23(18,19)17-9-10-22-14-6-4-3-5-13(14)17/h7-8,11,13-14H,3-6,9-10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | KJNTZWREPWAPGI-UONOGXRCSA-N |
| XLogP | 2.04 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |