C17H14Cl2N2O2S2 — CID 40819293
2-[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-benzothiazole (PubChem CID 40819293) has the molecular formula C17H14Cl2N2O2S2 and a molecular weight of 413.35 g/mol. Its IUPAC name is 2-[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 40819293 |
| Molecular Formula | C17H14Cl2N2O2S2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | 2-[(2R)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]-1,3-benzothiazole |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1)N1CCC[C@@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H14Cl2N2O2S2/c18-11-8-12(19)10-13(9-11)25(22,23)21-7-3-5-15(21)17-20-14-4-1-2-6-16(14)24-17/h1-2,4,6,8-10,15H,3,5,7H2/t15-/m1/s1 |
| InChIKey | DCANLZZDWGBFHM-OAHLLOKOSA-N |
| XLogP | 5.13 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |