C23H27N3O5S2 — CID 31791927
5-[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 31791927) has the molecular formula C23H27N3O5S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 5-[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 5-[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 31791927 |
| Molecular Formula | C23H27N3O5S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 5-[(2R)-2-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-2-methoxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)N2CCCC[C@@H]2c2nc3ccccc3s2)ccc1OC |
| InChI | InChI=1S/C23H27N3O5S2/c1-30-14-12-24-33(28,29)21-15-16(10-11-19(21)31-2)23(27)26-13-6-5-8-18(26)22-25-17-7-3-4-9-20(17)32-22/h3-4,7,9-11,15,18,24H,5-6,8,12-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | JXZZJKWKQKITBU-GOSISDBHSA-N |
| XLogP | 3.60 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|