C20H17Cl3N4O4S3 — CID 54498208
2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[(2-cyanoacetyl)amino]prop-1-en-2-yl]-4-oxoazetidin-1-yl]acetate (PubChem CID 54498208) has the molecular formula C20H17Cl3N4O4S3 and a molecular weight of 579.94 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[(2-cyanoacetyl)amino]prop-1-en-2-yl]-4-oxoazetidin-1-yl]acetate.
| Compound Name | 2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[(2-cyanoacetyl)amino]prop-1-en-2-yl]-4-oxoazetidin-1-yl]acetate |
|---|---|
| PubChem CID | 54498208 |
| Molecular Formula | C20H17Cl3N4O4S3 |
| Molecular Weight | 579.94 g/mol |
| Exact Mass | 577.95 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[(2-cyanoacetyl)amino]prop-1-en-2-yl]-4-oxoazetidin-1-yl]acetate |
| SMILES | CC(=CNC(=O)CC#N)C1C(=O)N(CC(=O)OCC(Cl)(Cl)Cl)C1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H17Cl3N4O4S3/c1-11(8-25-14(28)6-7-24)16-17(30)27(9-15(29)31-10-20(21,22)23)18(16)33-34-19-26-12-4-2-3-5-13(12)32-19/h2-5,8,16,18H,6,9-10H2,1H3,(H,25,28) |
| InChIKey | YAPKKISKYDFPLU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|