C26H23Cl3N4O6S3 — CID 88628748
benzyl 2-[(3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-formamido-4-oxo-2-prop-1-en-2-yl-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]acetate (PubChem CID 88628748) has the molecular formula C26H23Cl3N4O6S3 and a molecular weight of 690.05 g/mol. Its IUPAC name is benzyl 2-[(3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-formamido-4-oxo-2-prop-1-en-2-yl-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]acetate.
| Compound Name | benzyl 2-[(3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-formamido-4-oxo-2-prop-1-en-2-yl-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]acetate |
|---|---|
| PubChem CID | 88628748 |
| Molecular Formula | C26H23Cl3N4O6S3 |
| Molecular Weight | 690.05 g/mol |
| Exact Mass | 687.98 |
| IUPAC Name | benzyl 2-[(3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-formamido-4-oxo-2-prop-1-en-2-yl-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]acetate |
| SMILES | C=C(C)C1(SSc2nc3ccccc3s2)N(CC(=O)OCc2ccccc2)C(=O)[C@]1(NC=O)NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C26H23Cl3N4O6S3/c1-16(2)26(42-41-23-31-18-10-6-7-11-19(18)40-23)25(30-15-34,32-22(37)39-14-24(27,28)29)21(36)33(26)12-20(35)38-13-17-8-4-3-5-9-17/h3-11,15H,1,12-14H2,2H3,(H,30,34)(H,32,37)/t25-,26?/m0/s1 |
| InChIKey | OLRVLSDICCFSFE-PMCHYTPCSA-N |
| XLogP | 5.43 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.05 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|