C19H15Cl6N3O4S3 — CID 88832883
1,1,2-trichloroethyl (E)-4-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2,2,2-trichloroacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 88832883) has the molecular formula C19H15Cl6N3O4S3 and a molecular weight of 658.27 g/mol. Its IUPAC name is 1,1,2-trichloroethyl (E)-4-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2,2,2-trichloroacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | 1,1,2-trichloroethyl (E)-4-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2,2,2-trichloroacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 88832883 |
| Molecular Formula | C19H15Cl6N3O4S3 |
| Molecular Weight | 658.27 g/mol |
| Exact Mass | 654.84 |
| IUPAC Name | 1,1,2-trichloroethyl (E)-4-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2,2,2-trichloroacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | C/C(=C\C(=O)OC(Cl)(Cl)CCl)CN1C(=O)C(NC(=O)C(Cl)(Cl)Cl)C1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H15Cl6N3O4S3/c1-9(6-12(29)32-18(21,22)8-20)7-28-14(30)13(27-16(31)19(23,24)25)15(28)34-35-17-26-10-4-2-3-5-11(10)33-17/h2-6,13,15H,7-8H2,1H3,(H,27,31)/b9-6+ |
| InChIKey | NAIPDKGXUGCDJO-RMKNXTFCSA-N |
| XLogP | 5.92 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.27 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|