C32H29N3O7S3 — CID 21398298
benzyl 3-(acetyloxymethyl)-2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-3-enoate (PubChem CID 21398298) has the molecular formula C32H29N3O7S3 and a molecular weight of 663.80 g/mol. Its IUPAC name is benzyl 3-(acetyloxymethyl)-2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-3-enoate.
| Compound Name | benzyl 3-(acetyloxymethyl)-2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-3-enoate |
|---|---|
| PubChem CID | 21398298 |
| Molecular Formula | C32H29N3O7S3 |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.12 |
| IUPAC Name | benzyl 3-(acetyloxymethyl)-2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-3-enoate |
| SMILES | C=C(COC(C)=O)C(C(=O)OCc1ccccc1)N1C(=O)C(NC(=O)COc2ccccc2)C1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C32H29N3O7S3/c1-20(17-40-21(2)36)28(31(39)42-18-22-11-5-3-6-12-22)35-29(38)27(34-26(37)19-41-23-13-7-4-8-14-23)30(35)44-45-32-33-24-15-9-10-16-25(24)43-32/h3-16,27-28,30H,1,17-19H2,2H3,(H,34,37) |
| InChIKey | JCRPEVVRCIPXMY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|