C20H23N3O5S3 — CID 57183167
2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoic acid (PubChem CID 57183167) has the molecular formula C20H23N3O5S3 and a molecular weight of 481.62 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoic acid.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoic acid |
|---|---|
| PubChem CID | 57183167 |
| Molecular Formula | C20H23N3O5S3 |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoic acid |
| SMILES | C=C(C)C(C(=O)O)N1C(=O)C(NC(=O)OC(C)(C)C)C1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H23N3O5S3/c1-10(2)14(17(25)26)23-15(24)13(22-18(27)28-20(3,4)5)16(23)30-31-19-21-11-8-6-7-9-12(11)29-19/h6-9,13-14,16H,1H2,2-5H3,(H,22,27)(H,25,26) |
| InChIKey | RGXSFDALPWJFLQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|