C30H23F3N4O10S4 — CID 11018195
(4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-(trifluoromethylsulfonyloxy)but-2-enoate (PubChem CID 11018195) has the molecular formula C30H23F3N4O10S4 and a molecular weight of 784.79 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-(trifluoromethylsulfonyloxy)but-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-(trifluoromethylsulfonyloxy)but-2-enoate |
|---|---|
| PubChem CID | 11018195 |
| Molecular Formula | C30H23F3N4O10S4 |
| Molecular Weight | 784.79 g/mol |
| Exact Mass | 784.02 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-(trifluoromethylsulfonyloxy)but-2-enoate |
| SMILES | C/C(OS(=O)(=O)C(F)(F)F)=C(/C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)[C@@H](NC(=O)COc2ccccc2)[C@H]1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C30H23F3N4O10S4/c1-17(47-51(43,44)30(31,32)33)25(28(40)46-15-18-11-13-19(14-12-18)37(41)42)36-26(39)24(35-23(38)16-45-20-7-3-2-4-8-20)27(36)49-50-29-34-21-9-5-6-10-22(21)48-29/h2-14,24,27H,15-16H2,1H3,(H,35,38)/b25-17+/t24-,27-/m1/s1 |
| InChIKey | VRRFELMUHBXCMI-BFYPCDFGSA-N |
| XLogP | 5.52 |
| TPSA | 184.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.79 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|