C29H24N4O8S3 — CID 54717799
(4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 54717799) has the molecular formula C29H24N4O8S3 and a molecular weight of 652.73 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | (4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 54717799 |
| Molecular Formula | C29H24N4O8S3 |
| Molecular Weight | 652.73 g/mol |
| Exact Mass | 652.08 |
| IUPAC Name | (4-nitrophenyl)methyl (E)-2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | C/C(O)=C(/C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)[C@@H](NC(=O)COc2ccccc2)[C@H]1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C29H24N4O8S3/c1-17(34)25(28(37)41-15-18-11-13-19(14-12-18)33(38)39)32-26(36)24(31-23(35)16-40-20-7-3-2-4-8-20)27(32)43-44-29-30-21-9-5-6-10-22(21)42-29/h2-14,24,27,34H,15-16H2,1H3,(H,31,35)/b25-17+/t24-,27-/m1/s1 |
| InChIKey | XCQBNYNNABYMEO-BFYPCDFGSA-N |
| XLogP | 5.21 |
| TPSA | 161.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.73 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|