C22H19ClN4S2 — CID 102260228
(3S,4R)-3-(1,3-benzothiazol-2-yl)-1-tert-butyl-4-(3-chlorophenyl)-2-imino-5-sulfanylidenepyrrolidine-3-carbonitrile (PubChem CID 102260228) has the molecular formula C22H19ClN4S2 and a molecular weight of 439.01 g/mol. Its IUPAC name is (3S,4R)-3-(1,3-benzothiazol-2-yl)-1-tert-butyl-4-(3-chlorophenyl)-2-imino-5-sulfanylidenepyrrolidine-3-carbonitrile.
| Compound Name | (3S,4R)-3-(1,3-benzothiazol-2-yl)-1-tert-butyl-4-(3-chlorophenyl)-2-imino-5-sulfanylidenepyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 102260228 |
| Molecular Formula | C22H19ClN4S2 |
| Molecular Weight | 439.01 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (3S,4R)-3-(1,3-benzothiazol-2-yl)-1-tert-butyl-4-(3-chlorophenyl)-2-imino-5-sulfanylidenepyrrolidine-3-carbonitrile |
| SMILES | [H]/N=C1\N(C(C)(C)C)C(=S)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H19ClN4S2/c1-21(2,3)27-18(28)17(13-7-6-8-14(23)11-13)22(12-24,19(27)25)20-26-15-9-4-5-10-16(15)29-20/h4-11,17,25H,1-3H3/b25-19-/t17-,22+/m0/s1 |
| InChIKey | KJGRMGKNDYWRQU-DAMINXDGSA-N |
| XLogP | 5.91 |
| TPSA | 63.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.01 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|