C11H8F3NS — CID 166636791
2-[1-(trifluoromethyl)cyclopropyl]-1,3-benzothiazole (PubChem CID 166636791) has the molecular formula C11H8F3NS and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-[1-(trifluoromethyl)cyclopropyl]-1,3-benzothiazole.
| Compound Name | 2-[1-(trifluoromethyl)cyclopropyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 166636791 |
| Molecular Formula | C11H8F3NS |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 2-[1-(trifluoromethyl)cyclopropyl]-1,3-benzothiazole |
| SMILES | FC(F)(F)C1(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C11H8F3NS/c12-11(13,14)10(5-6-10)9-15-7-3-1-2-4-8(7)16-9/h1-4H,5-6H2 |
| InChIKey | FOMVIWSSENMFPZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |