C10H4ClF6NS — CID 10881727
2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1,3-benzothiazole (PubChem CID 10881727) has the molecular formula C10H4ClF6NS and a molecular weight of 319.66 g/mol. Its IUPAC name is 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1,3-benzothiazole.
| Compound Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 10881727 |
| Molecular Formula | C10H4ClF6NS |
| Molecular Weight | 319.66 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 2-(3-chloro-1,1,2,2,3,3-hexafluoropropyl)-1,3-benzothiazole |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H4ClF6NS/c11-10(16,17)9(14,15)8(12,13)7-18-5-3-1-2-4-6(5)19-7/h1-4H |
| InChIKey | XYKJUJQEPZFDHU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|