C15H4F17NO2S — CID 154179611
2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-benzothiazole (PubChem CID 154179611) has the molecular formula C15H4F17NO2S and a molecular weight of 585.24 g/mol. Its IUPAC name is 2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-benzothiazole.
| Compound Name | 2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 154179611 |
| Molecular Formula | C15H4F17NO2S |
| Molecular Weight | 585.24 g/mol |
| Exact Mass | 584.97 |
| IUPAC Name | 2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1,3-benzothiazole |
| SMILES | FC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H4F17NO2S/c16-8(11(20,21)22,7-33-5-3-1-2-4-6(5)36-7)34-15(31,32)10(19,13(26,27)28)35-14(29,30)9(17,18)12(23,24)25/h1-4H |
| InChIKey | IBCDMWGWGRYPAS-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.24 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|