C14H15F3N2O3S — CID 110888396
3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(3-hydroxypropyl)butanamide (PubChem CID 110888396) has the molecular formula C14H15F3N2O3S and a molecular weight of 348.35 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(3-hydroxypropyl)butanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(3-hydroxypropyl)butanamide |
|---|---|
| PubChem CID | 110888396 |
| Molecular Formula | C14H15F3N2O3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(3-hydroxypropyl)butanamide |
| SMILES | O=C(CC(O)(c1nc2ccccc2s1)C(F)(F)F)NCCCO |
| InChI | InChI=1S/C14H15F3N2O3S/c15-14(16,17)13(22,8-11(21)18-6-3-7-20)12-19-9-4-1-2-5-10(9)23-12/h1-2,4-5,20,22H,3,6-8H2,(H,18,21) |
| InChIKey | NBSUTLVAAMSGEU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|