C14H11F3N2O2S — CID 110884012
3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-prop-2-ynylbutanamide (PubChem CID 110884012) has the molecular formula C14H11F3N2O2S and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-prop-2-ynylbutanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-prop-2-ynylbutanamide |
|---|---|
| PubChem CID | 110884012 |
| Molecular Formula | C14H11F3N2O2S |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-prop-2-ynylbutanamide |
| SMILES | C#CCNC(=O)CC(O)(c1nc2ccccc2s1)C(F)(F)F |
| InChI | InChI=1S/C14H11F3N2O2S/c1-2-7-18-11(20)8-13(21,14(15,16)17)12-19-9-5-3-4-6-10(9)22-12/h1,3-6,21H,7-8H2,(H,18,20) |
| InChIKey | ZKFCSUWAARBTEV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|