C21H20F3N3O3S — CID 42937418
3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(4-morpholin-4-ylphenyl)butanamide (PubChem CID 42937418) has the molecular formula C21H20F3N3O3S and a molecular weight of 451.47 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(4-morpholin-4-ylphenyl)butanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(4-morpholin-4-ylphenyl)butanamide |
|---|---|
| PubChem CID | 42937418 |
| Molecular Formula | C21H20F3N3O3S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-4,4,4-trifluoro-3-hydroxy-N-(4-morpholin-4-ylphenyl)butanamide |
| SMILES | O=C(CC(O)(c1nc2ccccc2s1)C(F)(F)F)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H20F3N3O3S/c22-21(23,24)20(29,19-26-16-3-1-2-4-17(16)31-19)13-18(28)25-14-5-7-15(8-6-14)27-9-11-30-12-10-27/h1-8,29H,9-13H2,(H,25,28) |
| InChIKey | LFJYDEXREKIDLI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|