C11H12N2OS — CID 165437924
O-[[1-(1,3-benzothiazol-2-yl)cyclopropyl]methyl]hydroxylamine (PubChem CID 165437924) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is O-[[1-(1,3-benzothiazol-2-yl)cyclopropyl]methyl]hydroxylamine.
| Compound Name | O-[[1-(1,3-benzothiazol-2-yl)cyclopropyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 165437924 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | O-[[1-(1,3-benzothiazol-2-yl)cyclopropyl]methyl]hydroxylamine |
| SMILES | NOCC1(c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C11H12N2OS/c12-14-7-11(5-6-11)10-13-8-3-1-2-4-9(8)15-10/h1-4H,5-7,12H2 |
| InChIKey | OEBDNUUFAXQPGS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|