About [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine
[1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine (PubChem CID 117450469) has the molecular formula C17H16N2S
and a molecular weight of 280.40 g/mol. Its IUPAC name is [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine |
| PubChem CID | 117450469 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine |
| SMILES | NCC1(c2ccccc2-c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H16N2S/c18-11-17(9-10-17)13-6-2-1-5-12(13)16-19-14-7-3-4-8-15(14)20-16/h1-8H,9-11,18H2 |
| InChIKey | LGAKGUPIPYUOFN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine?
The IUPAC name of [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine (CID 117450469) is [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine.
What is the SMILES notation for [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine?
The canonical SMILES for [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine is NCC1(c2ccccc2-c2nc3ccccc3s2)CC1.
What is the InChIKey of [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine?
The InChIKey is LGAKGUPIPYUOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2S/c18-11-17(9-10-17)13-6-2-1-5-12(13)16-19-14-7-3-4-8-15(14)20-16/h1-8H,9-11,18H2.
What are the key properties of [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine?
[1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine has a molecular weight of 280.40 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine is sourced from PubChem (CID 117450469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).