C17H16N2S — CID 117450469
[1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine (PubChem CID 117450469) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine.
| Compound Name | [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 117450469 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | [1-[2-(1,3-benzothiazol-2-yl)phenyl]cyclopropyl]methanamine |
| SMILES | NCC1(c2ccccc2-c2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C17H16N2S/c18-11-17(9-10-17)13-6-2-1-5-12(13)16-19-14-7-3-4-8-15(14)20-16/h1-8H,9-11,18H2 |
| InChIKey | LGAKGUPIPYUOFN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |