C17H15ClN2OS — CID 177341624
2-(1,3-benzothiazol-2-yl)propanenitrile;(3-chlorophenyl)methanol (PubChem CID 177341624) has the molecular formula C17H15ClN2OS and a molecular weight of 330.84 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)propanenitrile;(3-chlorophenyl)methanol.
| Compound Name | 2-(1,3-benzothiazol-2-yl)propanenitrile;(3-chlorophenyl)methanol |
|---|---|
| PubChem CID | 177341624 |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.84 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)propanenitrile;(3-chlorophenyl)methanol |
| SMILES | CC(C#N)c1nc2ccccc2s1.OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C10H8N2S.C7H7ClO/c1-7(6-11)10-12-8-4-2-3-5-9(8)13-10;8-7-3-1-2-6(4-7)5-9/h2-5,7H,1H3;1-4,9H,5H2 |
| InChIKey | VJKGOZRMFOEVQV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.84 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |