C18H18ClN3S — CID 3762968
2-[(3-chlorophenyl)-piperazin-1-ylmethyl]-1,3-benzothiazole (PubChem CID 3762968) has the molecular formula C18H18ClN3S and a molecular weight of 343.88 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)-piperazin-1-ylmethyl]-1,3-benzothiazole.
| Compound Name | 2-[(3-chlorophenyl)-piperazin-1-ylmethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 3762968 |
| Molecular Formula | C18H18ClN3S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-[(3-chlorophenyl)-piperazin-1-ylmethyl]-1,3-benzothiazole |
| SMILES | Clc1cccc(C(c2nc3ccccc3s2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H18ClN3S/c19-14-5-3-4-13(12-14)17(22-10-8-20-9-11-22)18-21-15-6-1-2-7-16(15)23-18/h1-7,12,17,20H,8-11H2 |
| InChIKey | SIADXUUDOGCHDT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |