C21H19ClN2O3S — CID 141376598
3-(4-chloro-1,3-benzothiazol-2-yl)-7-[(3-hydroxypyrrolidin-1-yl)methyl]-3,4-dihydrochromen-2-one (PubChem CID 141376598) has the molecular formula C21H19ClN2O3S and a molecular weight of 414.91 g/mol. Its IUPAC name is 3-(4-chloro-1,3-benzothiazol-2-yl)-7-[(3-hydroxypyrrolidin-1-yl)methyl]-3,4-dihydrochromen-2-one.
| Compound Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-7-[(3-hydroxypyrrolidin-1-yl)methyl]-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 141376598 |
| Molecular Formula | C21H19ClN2O3S |
| Molecular Weight | 414.91 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 3-(4-chloro-1,3-benzothiazol-2-yl)-7-[(3-hydroxypyrrolidin-1-yl)methyl]-3,4-dihydrochromen-2-one |
| SMILES | O=C1Oc2cc(CN3CCC(O)C3)ccc2CC1c1nc2c(Cl)cccc2s1 |
| InChI | InChI=1S/C21H19ClN2O3S/c22-16-2-1-3-18-19(16)23-20(28-18)15-9-13-5-4-12(8-17(13)27-21(15)26)10-24-7-6-14(25)11-24/h1-5,8,14-15,25H,6-7,9-11H2 |
| InChIKey | DSMDEIYTAXQYPS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|