C19H18N2O2S — CID 75615082
2-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-1,3-benzothiazole (PubChem CID 75615082) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 75615082 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(C3CCN(Cc4ccc5c(c4)OCO5)C3)nc2c1 |
| InChI | InChI=1S/C19H18N2O2S/c1-2-4-18-15(3-1)20-19(24-18)14-7-8-21(11-14)10-13-5-6-16-17(9-13)23-12-22-16/h1-6,9,14H,7-8,10-12H2 |
| InChIKey | FTTOOMZQNBACIJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |