C19H19N3O2S — CID 171380510
2-[4-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,3-benzothiazole (PubChem CID 171380510) has the molecular formula C19H19N3O2S and a molecular weight of 361.50 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 171380510 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl]-1,3-benzothiazole |
| SMILES | [2H]C1([2H])N(Cc2ccc3c(c2)OCO3)C([2H])([2H])C([2H])([2H])N(c2nc3ccccc3s2)C1([2H])[2H] |
| InChI | InChI=1S/C19H19N3O2S/c1-2-4-18-15(3-1)20-19(25-18)22-9-7-21(8-10-22)12-14-5-6-16-17(11-14)24-13-23-16/h1-6,11H,7-10,12-13H2/i7D2,8D2,9D2,10D2 |
| InChIKey | BYHKGNWKJMGHGE-UFBJYANTSA-N |
| XLogP | 3.35 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |