C16H18N4O2 — CID 12804974
1-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuterio-4-pyrimidin-2-ylpiperazine (PubChem CID 12804974) has the molecular formula C16H18N4O2 and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuterio-4-pyrimidin-2-ylpiperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuterio-4-pyrimidin-2-ylpiperazine |
|---|---|
| PubChem CID | 12804974 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2,2,3,3,5,5,6,6-octadeuterio-4-pyrimidin-2-ylpiperazine |
| SMILES | [2H]C1([2H])N(Cc2ccc3c(c2)OCO3)C([2H])([2H])C([2H])([2H])N(c2ncccn2)C1([2H])[2H] |
| InChI | InChI=1S/C16H18N4O2/c1-4-17-16(18-5-1)20-8-6-19(7-9-20)11-13-2-3-14-15(10-13)22-12-21-14/h1-5,10H,6-9,11-12H2/i6D2,7D2,8D2,9D2 |
| InChIKey | OQDPVLVUJFGPGQ-COMRDEPKSA-N |
| XLogP | 1.53 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |