C23H32N6O — CID 108805731
1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-4-carboxamide (PubChem CID 108805731) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108805731 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-(4,6-dimethylpyrimidin-2-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCC(C(=O)Nc3ccc(N4CCN(C)CC4)cc3)CC2)n1 |
| InChI | InChI=1S/C23H32N6O/c1-17-16-18(2)25-23(24-17)29-10-8-19(9-11-29)22(30)26-20-4-6-21(7-5-20)28-14-12-27(3)13-15-28/h4-7,16,19H,8-15H2,1-3H3,(H,26,30) |
| InChIKey | HKGIVISYOSPOPX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|