C18H31N3 — CID 143655183
ethane;ethene;2-methyl-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole (PubChem CID 143655183) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is ethane;ethene;2-methyl-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole.
| Compound Name | ethane;ethene;2-methyl-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 143655183 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | ethane;ethene;2-methyl-5-(4-methylpiperazin-1-yl)-1,3-dihydroisoindole |
| SMILES | C=C.CC.CN1CCN(c2ccc3c(c2)CN(C)C3)CC1 |
| InChI | InChI=1S/C14H21N3.C2H6.C2H4/c1-15-5-7-17(8-6-15)14-4-3-12-10-16(2)11-13(12)9-14;2*1-2/h3-4,9H,5-8,10-11H2,1-2H3;1-2H3;1-2H2 |
| InChIKey | WFNXCSGFELKTCW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|