C22H13Cl2IN2O — CID 2833275
3-(2,4-dichlorophenyl)-N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine (PubChem CID 2833275) has the molecular formula C22H13Cl2IN2O and a molecular weight of 519.17 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 2833275 |
| Molecular Formula | C22H13Cl2IN2O |
| Molecular Weight | 519.17 g/mol |
| Exact Mass | 517.94 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[2-(4-iodophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
| SMILES | Clc1ccc(C=C/C=N/c2ccc3oc(-c4ccc(I)cc4)nc3c2)c(Cl)c1 |
| InChI | InChI=1S/C22H13Cl2IN2O/c23-16-6-3-14(19(24)12-16)2-1-11-26-18-9-10-21-20(13-18)27-22(28-21)15-4-7-17(25)8-5-15/h1-13H/b2-1?,26-11+ |
| InChIKey | LFHUBHPMTMADIX-ASVLQLIKSA-N |
| XLogP | 7.82 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.17 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|