C22H14Cl2N2O — CID 4320438
3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine (PubChem CID 4320438) has the molecular formula C22H14Cl2N2O and a molecular weight of 393.27 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine.
| Compound Name | 3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 4320438 |
| Molecular Formula | C22H14Cl2N2O |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]prop-2-en-1-imine |
| SMILES | Clc1ccc(C=C/C=N/c2ccc3oc(-c4ccc(Cl)cc4)nc3c2)cc1 |
| InChI | InChI=1S/C22H14Cl2N2O/c23-17-7-3-15(4-8-17)2-1-13-25-19-11-12-21-20(14-19)26-22(27-21)16-5-9-18(24)10-6-16/h1-14H/b2-1?,25-13+ |
| InChIKey | YFINLYBLTOAHSJ-AGWKDGQESA-N |
| XLogP | 7.22 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|