C24H19N3O3 — CID 2833290
N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-(4-nitrophenyl)prop-2-en-1-imine (PubChem CID 2833290) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-(4-nitrophenyl)prop-2-en-1-imine.
| Compound Name | N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-(4-nitrophenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 2833290 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-[4-(5,6-dimethyl-1,3-benzoxazol-2-yl)phenyl]-3-(4-nitrophenyl)prop-2-en-1-imine |
| SMILES | Cc1cc2nc(-c3ccc(/N=C/C=Cc4ccc([N+](=O)[O-])cc4)cc3)oc2cc1C |
| InChI | InChI=1S/C24H19N3O3/c1-16-14-22-23(15-17(16)2)30-24(26-22)19-7-9-20(10-8-19)25-13-3-4-18-5-11-21(12-6-18)27(28)29/h3-15H,1-2H3/b4-3?,25-13+ |
| InChIKey | OFZPYPUJFCNQMO-UJEWIGKLSA-N |
| XLogP | 6.44 |
| TPSA | 81.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|