C22H13BrCl2N2O — CID 2833260
N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-en-1-imine (PubChem CID 2833260) has the molecular formula C22H13BrCl2N2O and a molecular weight of 472.17 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-en-1-imine.
| Compound Name | N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 2833260 |
| Molecular Formula | C22H13BrCl2N2O |
| Molecular Weight | 472.17 g/mol |
| Exact Mass | 469.96 |
| IUPAC Name | N-[2-(4-bromophenyl)-1,3-benzoxazol-5-yl]-3-(2,4-dichlorophenyl)prop-2-en-1-imine |
| SMILES | Clc1ccc(C=C/C=N/c2ccc3oc(-c4ccc(Br)cc4)nc3c2)c(Cl)c1 |
| InChI | InChI=1S/C22H13BrCl2N2O/c23-16-6-3-15(4-7-16)22-27-20-13-18(9-10-21(20)28-22)26-11-1-2-14-5-8-17(24)12-19(14)25/h1-13H/b2-1?,26-11+ |
| InChIKey | HHSCNNWYQFNFEK-ASVLQLIKSA-N |
| XLogP | 7.98 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.17 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|