C26H15Cl3N4O2 — CID 5146852
4-[(4-chlorophenyl)diazenyl]-2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol (PubChem CID 5146852) has the molecular formula C26H15Cl3N4O2 and a molecular weight of 521.79 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)diazenyl]-2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol.
| Compound Name | 4-[(4-chlorophenyl)diazenyl]-2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 5146852 |
| Molecular Formula | C26H15Cl3N4O2 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 4-[(4-chlorophenyl)diazenyl]-2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenol |
| SMILES | Oc1ccc(/N=N/c2ccc(Cl)cc2)cc1/C=N/c1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C26H15Cl3N4O2/c27-17-2-4-18(5-3-17)32-33-20-6-9-24(34)16(11-20)14-30-19-7-10-25-23(13-19)31-26(35-25)15-1-8-21(28)22(29)12-15/h1-14,34H/b30-14+,33-32+ |
| InChIKey | GXIRJQGCJIJBKN-AYAZLWNVSA-N |
| XLogP | 9.33 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|