C27H15Cl2F3N4O2 — CID 3098670
2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol (PubChem CID 3098670) has the molecular formula C27H15Cl2F3N4O2 and a molecular weight of 555.34 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol.
| Compound Name | 2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol |
|---|---|
| PubChem CID | 3098670 |
| Molecular Formula | C27H15Cl2F3N4O2 |
| Molecular Weight | 555.34 g/mol |
| Exact Mass | 554.05 |
| IUPAC Name | 2-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[[3-(trifluoromethyl)phenyl]diazenyl]phenol |
| SMILES | Oc1ccc(/N=N/c2cccc(C(F)(F)F)c2)cc1/C=N/c1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C27H15Cl2F3N4O2/c28-21-7-4-15(11-22(21)29)26-34-23-13-18(6-9-25(23)38-26)33-14-16-10-20(5-8-24(16)37)36-35-19-3-1-2-17(12-19)27(30,31)32/h1-14,37H/b33-14+,36-35+ |
| InChIKey | VGEBDMGNWPMPCT-HQEQJGOVSA-N |
| XLogP | 9.69 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.34 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|