C20H13Cl2N3O2 — CID 9239381
3-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 9239381) has the molecular formula C20H13Cl2N3O2 and a molecular weight of 398.25 g/mol. Its IUPAC name is 3-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 3-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 9239381 |
| Molecular Formula | C20H13Cl2N3O2 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | 3-[(Z)-[5-(2,5-dichlorophenyl)furan-2-yl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1/N=C\c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C20H13Cl2N3O2/c1-12-24-18-5-3-2-4-15(18)20(26)25(12)23-11-14-7-9-19(27-14)16-10-13(21)6-8-17(16)22/h2-11H,1H3/b23-11- |
| InChIKey | ABDRCPBYXNNOQB-KSEXSDGBSA-N |
| XLogP | 5.15 |
| TPSA | 60.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|