C21H13BrN4O2 — CID 126306676
2-[5-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzonitrile (PubChem CID 126306676) has the molecular formula C21H13BrN4O2 and a molecular weight of 433.27 g/mol. Its IUPAC name is 2-[5-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzonitrile.
| Compound Name | 2-[5-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzonitrile |
|---|---|
| PubChem CID | 126306676 |
| Molecular Formula | C21H13BrN4O2 |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2-[5-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]furan-2-yl]benzonitrile |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(-c2ccccc2C#N)o1 |
| InChI | InChI=1S/C21H13BrN4O2/c1-13-25-19-8-6-15(22)10-18(19)21(27)26(13)24-12-16-7-9-20(28-16)17-5-3-2-4-14(17)11-23/h2-10,12H,1H3 |
| InChIKey | ZKDGFTZDWRCFIT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|