C24H16BrClN4O2 — CID 126307506
2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chlorophenoxy]methyl]benzonitrile (PubChem CID 126307506) has the molecular formula C24H16BrClN4O2 and a molecular weight of 507.78 g/mol. Its IUPAC name is 2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chlorophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chlorophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126307506 |
| Molecular Formula | C24H16BrClN4O2 |
| Molecular Weight | 507.78 g/mol |
| Exact Mass | 506.01 |
| IUPAC Name | 2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-chlorophenoxy]methyl]benzonitrile |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccccc2C#N)c(Cl)c1 |
| InChI | InChI=1S/C24H16BrClN4O2/c1-15-29-22-8-7-19(25)11-20(22)24(31)30(15)28-13-16-6-9-23(21(26)10-16)32-14-18-5-3-2-4-17(18)12-27/h2-11,13H,14H2,1H3 |
| InChIKey | AVZOHGMBOFDGSD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.78 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|