C26H21BrN4O3 — CID 126293577
2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]methyl]benzonitrile (PubChem CID 126293577) has the molecular formula C26H21BrN4O3 and a molecular weight of 517.38 g/mol. Its IUPAC name is 2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126293577 |
| Molecular Formula | C26H21BrN4O3 |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 516.08 |
| IUPAC Name | 2-[[4-[(6-bromo-2-methyl-4-oxoquinazolin-3-yl)iminomethyl]-2-ethoxyphenoxy]methyl]benzonitrile |
| SMILES | CCOc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H21BrN4O3/c1-3-33-25-12-18(8-11-24(25)34-16-20-7-5-4-6-19(20)14-28)15-29-31-17(2)30-23-10-9-21(27)13-22(23)26(31)32/h4-13,15H,3,16H2,1-2H3 |
| InChIKey | VCSDUBSIIORGJU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 89.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|