C25H18BrN5O4 — CID 126295266
2-[[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]methyl]benzonitrile (PubChem CID 126295266) has the molecular formula C25H18BrN5O4 and a molecular weight of 532.35 g/mol. Its IUPAC name is 2-[[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126295266 |
| Molecular Formula | C25H18BrN5O4 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 2-[[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]methyl]benzonitrile |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccccc2C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H18BrN5O4/c1-2-24-29-21-9-8-19(26)12-20(21)25(32)30(24)28-14-16-7-10-23(22(11-16)31(33)34)35-15-18-6-4-3-5-17(18)13-27/h3-12,14H,2,15H2,1H3 |
| InChIKey | KVPSYAOCXCLTBB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 123.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|