C20H17BrN4O6 — CID 126283243
(2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]propanoic acid (PubChem CID 126283243) has the molecular formula C20H17BrN4O6 and a molecular weight of 489.28 g/mol. Its IUPAC name is (2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 126283243 |
| Molecular Formula | C20H17BrN4O6 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | (2R)-2-[4-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2-nitrophenoxy]propanoic acid |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(O[C@H](C)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17BrN4O6/c1-3-18-23-15-6-5-13(21)9-14(15)19(26)24(18)22-10-12-4-7-17(16(8-12)25(29)30)31-11(2)20(27)28/h4-11H,3H2,1-2H3,(H,27,28)/t11-/m1/s1 |
| InChIKey | BCGWRIOTEBWWDW-LLVKDONJSA-N |
| XLogP | 3.36 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|