C23H16BrClN4O4 — CID 126282642
6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126282642) has the molecular formula C23H16BrClN4O4 and a molecular weight of 527.76 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126282642 |
| Molecular Formula | C23H16BrClN4O4 |
| Molecular Weight | 527.76 g/mol |
| Exact Mass | 526.00 |
| IUPAC Name | 6-bromo-3-[[4-[(2-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16BrClN4O4/c1-14-27-20-8-7-17(24)11-18(20)23(30)28(14)26-12-15-6-9-22(21(10-15)29(31)32)33-13-16-4-2-3-5-19(16)25/h2-12H,13H2,1H3 |
| InChIKey | RTCFKBFOUAICTL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.76 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|