C26H20BrN5O4 — CID 126298533
2-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile (PubChem CID 126298533) has the molecular formula C26H20BrN5O4 and a molecular weight of 546.38 g/mol. Its IUPAC name is 2-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126298533 |
| Molecular Formula | C26H20BrN5O4 |
| Molecular Weight | 546.38 g/mol |
| Exact Mass | 545.07 |
| IUPAC Name | 2-[[2-[(6-bromo-4-oxo-2-propan-2-ylquinazolin-3-yl)iminomethyl]-6-nitrophenoxy]methyl]benzonitrile |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc([N+](=O)[O-])c1OCc1ccccc1C#N |
| InChI | InChI=1S/C26H20BrN5O4/c1-16(2)25-30-22-11-10-20(27)12-21(22)26(33)31(25)29-14-18-8-5-9-23(32(34)35)24(18)36-15-19-7-4-3-6-17(19)13-28/h3-12,14,16H,15H2,1-2H3 |
| InChIKey | DUVRRQJBNFQTII-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 123.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|