C25H18Br4N4O4 — CID 126298734
6-bromo-3-[[5-bromo-2-[(2,4-dibromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 126298734) has the molecular formula C25H18Br4N4O4 and a molecular weight of 758.06 g/mol. Its IUPAC name is 6-bromo-3-[[5-bromo-2-[(2,4-dibromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-bromo-2-[(2,4-dibromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126298734 |
| Molecular Formula | C25H18Br4N4O4 |
| Molecular Weight | 758.06 g/mol |
| Exact Mass | 753.81 |
| IUPAC Name | 6-bromo-3-[[5-bromo-2-[(2,4-dibromophenyl)methoxy]-3-nitrophenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C25H18Br4N4O4/c1-13(2)24-31-21-6-5-16(26)8-19(21)25(34)32(24)30-11-15-7-18(28)10-22(33(35)36)23(15)37-12-14-3-4-17(27)9-20(14)29/h3-11,13H,12H2,1-2H3 |
| InChIKey | HIAZKQVGGORJIC-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.06 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|