C27H21BrCl2N4O2 — CID 126333808
2-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzonitrile (PubChem CID 126333808) has the molecular formula C27H21BrCl2N4O2 and a molecular weight of 584.30 g/mol. Its IUPAC name is 2-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126333808 |
| Molecular Formula | C27H21BrCl2N4O2 |
| Molecular Weight | 584.30 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | 2-[[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]methyl]benzonitrile |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(OCc2ccccc2C#N)c(Cl)c1 |
| InChI | InChI=1S/C27H21BrCl2N4O2/c1-3-16(2)26-33-24-9-8-20(28)12-21(24)27(35)34(26)32-14-17-10-22(29)25(23(30)11-17)36-15-19-7-5-4-6-18(19)13-31/h4-12,14,16H,3,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | VUNVCJZNJVLNOY-MRXNPFEDSA-N |
| XLogP | 7.31 |
| TPSA | 80.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.30 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|