C24H20BrN3O4 — CID 126327925
2-[5-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoic acid (PubChem CID 126327925) has the molecular formula C24H20BrN3O4 and a molecular weight of 494.35 g/mol. Its IUPAC name is 2-[5-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126327925 |
| Molecular Formula | C24H20BrN3O4 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-[5-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]furan-2-yl]benzoic acid |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(-c2ccccc2C(=O)O)o1 |
| InChI | InChI=1S/C24H20BrN3O4/c1-3-14(2)22-27-20-10-8-15(25)12-19(20)23(29)28(22)26-13-16-9-11-21(32-16)17-6-4-5-7-18(17)24(30)31/h4-14H,3H2,1-2H3,(H,30,31)/t14-/m0/s1 |
| InChIKey | JKZLNSZJGHUTAG-AWEZNQCLSA-N |
| XLogP | 5.51 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|